About N',N'-dimethyl-N-non-1-en-4-ylethane-1,2-diamine
N',N'-dimethyl-N-non-1-en-4-ylethane-1,2-diamine (PubChem CID 88772969) has the molecular formula C13H28N2
and a molecular weight of 212.38 g/mol. Its IUPAC name is N',N'-dimethyl-N-non-1-en-4-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N',N'-dimethyl-N-non-1-en-4-ylethane-1,2-diamine |
| PubChem CID | 88772969 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | N',N'-dimethyl-N-non-1-en-4-ylethane-1,2-diamine |
| SMILES | C=CCC(CCCCC)NCCN(C)C |
| InChI | InChI=1S/C13H28N2/c1-5-7-8-10-13(9-6-2)14-11-12-15(3)4/h6,13-14H,2,5,7-12H2,1,3-4H3 |
| InChIKey | UAGKYNUAAGRFLI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N',N'-dimethyl-N-non-1-en-4-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-dimethyl-N-non-1-en-4-ylethane-1,2-diamine?
The IUPAC name of N',N'-dimethyl-N-non-1-en-4-ylethane-1,2-diamine (CID 88772969) is N',N'-dimethyl-N-non-1-en-4-ylethane-1,2-diamine.
What is the SMILES notation for N',N'-dimethyl-N-non-1-en-4-ylethane-1,2-diamine?
The canonical SMILES for N',N'-dimethyl-N-non-1-en-4-ylethane-1,2-diamine is C=CCC(CCCCC)NCCN(C)C.
What is the InChIKey of N',N'-dimethyl-N-non-1-en-4-ylethane-1,2-diamine?
The InChIKey is UAGKYNUAAGRFLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2/c1-5-7-8-10-13(9-6-2)14-11-12-15(3)4/h6,13-14H,2,5,7-12H2,1,3-4H3.
What are the key properties of N',N'-dimethyl-N-non-1-en-4-ylethane-1,2-diamine?
N',N'-dimethyl-N-non-1-en-4-ylethane-1,2-diamine has a molecular weight of 212.38 g/mol, XLogP of 2.66, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-dimethyl-N-non-1-en-4-ylethane-1,2-diamine is sourced from PubChem (CID 88772969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).