About 1-(3,5-dichlorophenyl)-1-oxo-N-(pyridin-4-ylmethyl)methanamine oxide
1-(3,5-dichlorophenyl)-1-oxo-N-(pyridin-4-ylmethyl)methanamine oxide (PubChem CID 88773112) has the molecular formula C13H10Cl2N2O2
and a molecular weight of 297.14 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-1-oxo-N-(pyridin-4-ylmethyl)methanamine oxide.
Molecular Properties
| Compound Name | 1-(3,5-dichlorophenyl)-1-oxo-N-(pyridin-4-ylmethyl)methanamine oxide |
| PubChem CID | 88773112 |
| Molecular Formula | C13H10Cl2N2O2 |
| Molecular Weight | 297.14 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-1-oxo-N-(pyridin-4-ylmethyl)methanamine oxide |
| SMILES | O=C(c1cc(Cl)cc(Cl)c1)[NH+]([O-])Cc1ccncc1 |
| InChI | InChI=1S/C13H10Cl2N2O2/c14-11-5-10(6-12(15)7-11)13(18)17(19)8-9-1-3-16-4-2-9/h1-7,17H,8H2 |
| InChIKey | CGCPQURYSSTOIU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 57.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.14 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-dichlorophenyl)-1-oxo-N-(pyridin-4-ylmethyl)methanamine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dichlorophenyl)-1-oxo-N-(pyridin-4-ylmethyl)methanamine oxide?
The IUPAC name of 1-(3,5-dichlorophenyl)-1-oxo-N-(pyridin-4-ylmethyl)methanamine oxide (CID 88773112) is 1-(3,5-dichlorophenyl)-1-oxo-N-(pyridin-4-ylmethyl)methanamine oxide.
What is the SMILES notation for 1-(3,5-dichlorophenyl)-1-oxo-N-(pyridin-4-ylmethyl)methanamine oxide?
The canonical SMILES for 1-(3,5-dichlorophenyl)-1-oxo-N-(pyridin-4-ylmethyl)methanamine oxide is O=C(c1cc(Cl)cc(Cl)c1)[NH+]([O-])Cc1ccncc1.
What is the InChIKey of 1-(3,5-dichlorophenyl)-1-oxo-N-(pyridin-4-ylmethyl)methanamine oxide?
The InChIKey is CGCPQURYSSTOIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2N2O2/c14-11-5-10(6-12(15)7-11)13(18)17(19)8-9-1-3-16-4-2-9/h1-7,17H,8H2.
What are the key properties of 1-(3,5-dichlorophenyl)-1-oxo-N-(pyridin-4-ylmethyl)methanamine oxide?
1-(3,5-dichlorophenyl)-1-oxo-N-(pyridin-4-ylmethyl)methanamine oxide has a molecular weight of 297.14 g/mol, XLogP of 2.11, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dichlorophenyl)-1-oxo-N-(pyridin-4-ylmethyl)methanamine oxide is sourced from PubChem (CID 88773112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).