About octane-2,3-dione;2-oxo-4-phenylbutanal;pentane-2,3-dione
octane-2,3-dione;2-oxo-4-phenylbutanal;pentane-2,3-dione (PubChem CID 88773280) has the molecular formula C23H32O6
and a molecular weight of 404.50 g/mol. Its IUPAC name is octane-2,3-dione;2-oxo-4-phenylbutanal;pentane-2,3-dione.
Molecular Properties
| Compound Name | octane-2,3-dione;2-oxo-4-phenylbutanal;pentane-2,3-dione |
| PubChem CID | 88773280 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | octane-2,3-dione;2-oxo-4-phenylbutanal;pentane-2,3-dione |
| SMILES | CCC(=O)C(C)=O.CCCCCC(=O)C(C)=O.O=CC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C10H10O2.C8H14O2.C5H8O2/c11-8-10(12)7-6-9-4-2-1-3-5-9;1-3-4-5-6-8(10)7(2)9;1-3-5(7)4(2)6/h1-5,8H,6-7H2;3-6H2,1-2H3;3H2,1-2H3 |
| InChIKey | NYNCWTMLQWNBLU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze octane-2,3-dione;2-oxo-4-phenylbutanal;pentane-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octane-2,3-dione;2-oxo-4-phenylbutanal;pentane-2,3-dione?
The IUPAC name of octane-2,3-dione;2-oxo-4-phenylbutanal;pentane-2,3-dione (CID 88773280) is octane-2,3-dione;2-oxo-4-phenylbutanal;pentane-2,3-dione.
What is the SMILES notation for octane-2,3-dione;2-oxo-4-phenylbutanal;pentane-2,3-dione?
The canonical SMILES for octane-2,3-dione;2-oxo-4-phenylbutanal;pentane-2,3-dione is CCC(=O)C(C)=O.CCCCCC(=O)C(C)=O.O=CC(=O)CCc1ccccc1.
What is the InChIKey of octane-2,3-dione;2-oxo-4-phenylbutanal;pentane-2,3-dione?
The InChIKey is NYNCWTMLQWNBLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2.C8H14O2.C5H8O2/c11-8-10(12)7-6-9-4-2-1-3-5-9;1-3-4-5-6-8(10)7(2)9;1-3-5(7)4(2)6/h1-5,8H,6-7H2;3-6H2,1-2H3;3H2,1-2H3.
What are the key properties of octane-2,3-dione;2-oxo-4-phenylbutanal;pentane-2,3-dione?
octane-2,3-dione;2-oxo-4-phenylbutanal;pentane-2,3-dione has a molecular weight of 404.50 g/mol, XLogP of 3.67, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for octane-2,3-dione;2-oxo-4-phenylbutanal;pentane-2,3-dione is sourced from PubChem (CID 88773280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).