7-oxabicyclo[4.1.0]hepta-2,4-diene-1,4-dicarboxylic acid

C8H6O5 — CID 88773396

IUPAC7-oxabicyclo[4.1.0]hepta-2,4-diene-1,4-dicarboxylic acid
SMILESO=C(O)C1=CC2OC2(C(=O)O)C=C1
InChIInChI=1S/C8H6O5/c9-6(10)4-1-2-8(7(11)12)5(3-4)13-8/h1-3,5H,(H,9,10)(H,11,12)
InChIKeyIPCRARCFERITOG-UHFFFAOYSA-N
MW182.13 g/mol
LogP-0.21
Rot. Bonds2

About 7-oxabicyclo[4.1.0]hepta-2,4-diene-1,4-dicarboxylic acid

7-oxabicyclo[4.1.0]hepta-2,4-diene-1,4-dicarboxylic acid (PubChem CID 88773396) has the molecular formula C8H6O5 and a molecular weight of 182.13 g/mol. Its IUPAC name is 7-oxabicyclo[4.1.0]hepta-2,4-diene-1,4-dicarboxylic acid.

Molecular Properties

Compound Name7-oxabicyclo[4.1.0]hepta-2,4-diene-1,4-dicarboxylic acid
PubChem CID88773396
Molecular FormulaC8H6O5
Molecular Weight182.13 g/mol
Exact Mass182.02
IUPAC Name7-oxabicyclo[4.1.0]hepta-2,4-diene-1,4-dicarboxylic acid
SMILESO=C(O)C1=CC2OC2(C(=O)O)C=C1
InChIInChI=1S/C8H6O5/c9-6(10)4-1-2-8(7(11)12)5(3-4)13-8/h1-3,5H,(H,9,10)(H,11,12)
InChIKeyIPCRARCFERITOG-UHFFFAOYSA-N
XLogP-0.21
TPSA87.13 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.13
LogP ≤ 5-0.21
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze 7-oxabicyclo[4.1.0]hepta-2,4-diene-1,4-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-oxabicyclo[4.1.0]hepta-2,4-diene-1,4-dicarboxylic acid?
The IUPAC name of 7-oxabicyclo[4.1.0]hepta-2,4-diene-1,4-dicarboxylic acid (CID 88773396) is 7-oxabicyclo[4.1.0]hepta-2,4-diene-1,4-dicarboxylic acid.
What is the SMILES notation for 7-oxabicyclo[4.1.0]hepta-2,4-diene-1,4-dicarboxylic acid?
The canonical SMILES for 7-oxabicyclo[4.1.0]hepta-2,4-diene-1,4-dicarboxylic acid is O=C(O)C1=CC2OC2(C(=O)O)C=C1.
What is the InChIKey of 7-oxabicyclo[4.1.0]hepta-2,4-diene-1,4-dicarboxylic acid?
The InChIKey is IPCRARCFERITOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O5/c9-6(10)4-1-2-8(7(11)12)5(3-4)13-8/h1-3,5H,(H,9,10)(H,11,12).
What are the key properties of 7-oxabicyclo[4.1.0]hepta-2,4-diene-1,4-dicarboxylic acid?
7-oxabicyclo[4.1.0]hepta-2,4-diene-1,4-dicarboxylic acid has a molecular weight of 182.13 g/mol, XLogP of -0.21, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxabicyclo[4.1.0]hepta-2,4-diene-1,4-dicarboxylic acid is sourced from PubChem (CID 88773396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).