C20H19NO4 — CID 88773450
13,15-dimethoxy-14-methyl-5,7-dioxa-14-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1,3,8,10,12(20),16,18-heptaene (PubChem CID 88773450) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is 13,15-dimethoxy-14-methyl-5,7-dioxa-14-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1,3,8,10,12(20),16,18-heptaene.
| Compound Name | 13,15-dimethoxy-14-methyl-5,7-dioxa-14-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1,3,8,10,12(20),16,18-heptaene |
|---|---|
| PubChem CID | 88773450 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 13,15-dimethoxy-14-methyl-5,7-dioxa-14-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1,3,8,10,12(20),16,18-heptaene |
| SMILES | COC1c2cccc3c2c(cc2cc4c(cc23)OCO4)C(OC)N1C |
| InChI | InChI=1S/C20H19NO4/c1-21-19(22-2)13-6-4-5-12-14-9-17-16(24-10-25-17)8-11(14)7-15(18(12)13)20(21)23-3/h4-9,19-20H,10H2,1-3H3 |
| InChIKey | VNNJTNIIBGQTGX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|