About hexa-3,5-dienimidamide
hexa-3,5-dienimidamide (PubChem CID 88773677) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is hexa-3,5-dienimidamide.
Molecular Properties
| Compound Name | hexa-3,5-dienimidamide |
| PubChem CID | 88773677 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | hexa-3,5-dienimidamide |
| SMILES | [H]/N=C(/N)CC=CC=C |
| InChI | InChI=1S/C6H10N2/c1-2-3-4-5-6(7)8/h2-4H,1,5H2,(H3,7,8) |
| InChIKey | YAGSPJAOPDOHJZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze hexa-3,5-dienimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexa-3,5-dienimidamide?
The IUPAC name of hexa-3,5-dienimidamide (CID 88773677) is hexa-3,5-dienimidamide.
What is the SMILES notation for hexa-3,5-dienimidamide?
The canonical SMILES for hexa-3,5-dienimidamide is [H]/N=C(/N)CC=CC=C.
What is the InChIKey of hexa-3,5-dienimidamide?
The InChIKey is YAGSPJAOPDOHJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2/c1-2-3-4-5-6(7)8/h2-4H,1,5H2,(H3,7,8).
What are the key properties of hexa-3,5-dienimidamide?
hexa-3,5-dienimidamide has a molecular weight of 110.16 g/mol, XLogP of 1.05, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexa-3,5-dienimidamide is sourced from PubChem (CID 88773677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).