About 1-(5-bromopentyl)-6-butyl-3,1-benzoxazine-2,4-dione
1-(5-bromopentyl)-6-butyl-3,1-benzoxazine-2,4-dione (PubChem CID 88773695) has the molecular formula C17H22BrNO3
and a molecular weight of 368.27 g/mol. Its IUPAC name is 1-(5-bromopentyl)-6-butyl-3,1-benzoxazine-2,4-dione.
Molecular Properties
| Compound Name | 1-(5-bromopentyl)-6-butyl-3,1-benzoxazine-2,4-dione |
| PubChem CID | 88773695 |
| Molecular Formula | C17H22BrNO3 |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 1-(5-bromopentyl)-6-butyl-3,1-benzoxazine-2,4-dione |
| SMILES | CCCCc1ccc2c(c1)c(=O)oc(=O)n2CCCCCBr |
| InChI | InChI=1S/C17H22BrNO3/c1-2-3-7-13-8-9-15-14(12-13)16(20)22-17(21)19(15)11-6-4-5-10-18/h8-9,12H,2-7,10-11H2,1H3 |
| InChIKey | YNAFDPOZQKYSGP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-bromopentyl)-6-butyl-3,1-benzoxazine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromopentyl)-6-butyl-3,1-benzoxazine-2,4-dione?
The IUPAC name of 1-(5-bromopentyl)-6-butyl-3,1-benzoxazine-2,4-dione (CID 88773695) is 1-(5-bromopentyl)-6-butyl-3,1-benzoxazine-2,4-dione.
What is the SMILES notation for 1-(5-bromopentyl)-6-butyl-3,1-benzoxazine-2,4-dione?
The canonical SMILES for 1-(5-bromopentyl)-6-butyl-3,1-benzoxazine-2,4-dione is CCCCc1ccc2c(c1)c(=O)oc(=O)n2CCCCCBr.
What is the InChIKey of 1-(5-bromopentyl)-6-butyl-3,1-benzoxazine-2,4-dione?
The InChIKey is YNAFDPOZQKYSGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22BrNO3/c1-2-3-7-13-8-9-15-14(12-13)16(20)22-17(21)19(15)11-6-4-5-10-18/h8-9,12H,2-7,10-11H2,1H3.
What are the key properties of 1-(5-bromopentyl)-6-butyl-3,1-benzoxazine-2,4-dione?
1-(5-bromopentyl)-6-butyl-3,1-benzoxazine-2,4-dione has a molecular weight of 368.27 g/mol, XLogP of 3.86, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromopentyl)-6-butyl-3,1-benzoxazine-2,4-dione is sourced from PubChem (CID 88773695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).