C15H20N9NaO8S2 — CID 88773775
sodium 3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-3-(5-methyltetrazol-5-yl)sulfanylpropanoyl]amino]-2-oxoazetidine-1-sulfonate (PubChem CID 88773775) has the molecular formula C15H20N9NaO8S2 and a molecular weight of 541.50 g/mol. Its IUPAC name is sodium 3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-3-(5-methyltetrazol-5-yl)sulfanylpropanoyl]amino]-2-oxoazetidine-1-sulfonate.
| Compound Name | sodium 3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-3-(5-methyltetrazol-5-yl)sulfanylpropanoyl]amino]-2-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 88773775 |
| Molecular Formula | C15H20N9NaO8S2 |
| Molecular Weight | 541.50 g/mol |
| Exact Mass | 541.08 |
| IUPAC Name | sodium 3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-3-(5-methyltetrazol-5-yl)sulfanylpropanoyl]amino]-2-oxoazetidine-1-sulfonate |
| SMILES | CCN1CCN(C(=O)NC(CSC2(C)N=NN=N2)C(=O)NC2CN(S(=O)(=O)[O-])C2=O)C(=O)C1=O.[Na+] |
| InChI | InChI=1S/C15H21N9O8S2.Na/c1-3-22-4-5-23(13(28)12(22)27)14(29)17-9(7-33-15(2)18-20-21-19-15)10(25)16-8-6-24(11(8)26)34(30,31)32;/h8-9H,3-7H2,1-2H3,(H,16,25)(H,17,29)(H,30,31,32);/q;+1/p-1 |
| InChIKey | YXCVJBMBKPATNG-UHFFFAOYSA-M |
| XLogP | -5.21 |
| TPSA | 225.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.50 |
| LogP ≤ 5 | -5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|