About potassium;carbanide;4-methyl-3H-purine-2,6-dione
potassium;carbanide;4-methyl-3H-purine-2,6-dione (PubChem CID 88774272) has the molecular formula C7H9KN4O2
and a molecular weight of 220.27 g/mol. Its IUPAC name is potassium;carbanide;4-methyl-3H-purine-2,6-dione.
Molecular Properties
| Compound Name | potassium;carbanide;4-methyl-3H-purine-2,6-dione |
| PubChem CID | 88774272 |
| Molecular Formula | C7H9KN4O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | potassium;carbanide;4-methyl-3H-purine-2,6-dione |
| SMILES | CC12N=CN=C1C(=O)NC(=O)N2.[CH3-].[K+] |
| InChI | InChI=1S/C6H6N4O2.CH3.K/c1-6-3(7-2-8-6)4(11)9-5(12)10-6;;/h2H,1H3,(H2,9,10,11,12);1H3;/q;-1;+1 |
| InChIKey | QTXVSJMXOYXIDY-UHFFFAOYSA-N |
| XLogP | -3.52 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium;carbanide;4-methyl-3H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;carbanide;4-methyl-3H-purine-2,6-dione?
The IUPAC name of potassium;carbanide;4-methyl-3H-purine-2,6-dione (CID 88774272) is potassium;carbanide;4-methyl-3H-purine-2,6-dione.
What is the SMILES notation for potassium;carbanide;4-methyl-3H-purine-2,6-dione?
The canonical SMILES for potassium;carbanide;4-methyl-3H-purine-2,6-dione is CC12N=CN=C1C(=O)NC(=O)N2.[CH3-].[K+].
What is the InChIKey of potassium;carbanide;4-methyl-3H-purine-2,6-dione?
The InChIKey is QTXVSJMXOYXIDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O2.CH3.K/c1-6-3(7-2-8-6)4(11)9-5(12)10-6;;/h2H,1H3,(H2,9,10,11,12);1H3;/q;-1;+1.
What are the key properties of potassium;carbanide;4-methyl-3H-purine-2,6-dione?
potassium;carbanide;4-methyl-3H-purine-2,6-dione has a molecular weight of 220.27 g/mol, XLogP of -3.52, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;carbanide;4-methyl-3H-purine-2,6-dione is sourced from PubChem (CID 88774272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).