C21H29FO — CID 88774314
(1S,2S,10S,11S,14S,15R,17S)-14-ethyl-5-fluoro-2,15-dimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-diene (PubChem CID 88774314) has the molecular formula C21H29FO and a molecular weight of 316.46 g/mol. Its IUPAC name is (1S,2S,10S,11S,14S,15R,17S)-14-ethyl-5-fluoro-2,15-dimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-diene.
| Compound Name | (1S,2S,10S,11S,14S,15R,17S)-14-ethyl-5-fluoro-2,15-dimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-diene |
|---|---|
| PubChem CID | 88774314 |
| Molecular Formula | C21H29FO |
| Molecular Weight | 316.46 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (1S,2S,10S,11S,14S,15R,17S)-14-ethyl-5-fluoro-2,15-dimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-diene |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3CCC4=CC(F)C=C[C@]4(C)[C@@]34O[C@H]4C[C@]12C |
| InChI | InChI=1S/C21H29FO/c1-4-13-5-7-16-17-8-6-14-11-15(22)9-10-20(14,3)21(17)18(23-21)12-19(13,16)2/h9-11,13,15-18H,4-8,12H2,1-3H3/t13-,15?,16-,17-,18-,19+,20-,21+/m0/s1 |
| InChIKey | XFZPLMBGQXBZFT-CQMIYTKKSA-N |
| XLogP | 5.22 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.46 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|