About chloroform;(Z)-3-(2-methylpropanoylamino)but-2-enamide
chloroform;(Z)-3-(2-methylpropanoylamino)but-2-enamide (PubChem CID 88774362) has the molecular formula C9H15Cl3N2O2
and a molecular weight of 289.59 g/mol. Its IUPAC name is chloroform;(Z)-3-(2-methylpropanoylamino)but-2-enamide.
Molecular Properties
| Compound Name | chloroform;(Z)-3-(2-methylpropanoylamino)but-2-enamide |
| PubChem CID | 88774362 |
| Molecular Formula | C9H15Cl3N2O2 |
| Molecular Weight | 289.59 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | chloroform;(Z)-3-(2-methylpropanoylamino)but-2-enamide |
| SMILES | C/C(=C/C(N)=O)NC(=O)C(C)C.ClC(Cl)Cl |
| InChI | InChI=1S/C8H14N2O2.CHCl3/c1-5(2)8(12)10-6(3)4-7(9)11;2-1(3)4/h4-5H,1-3H3,(H2,9,11)(H,10,12);1H/b6-4-; |
| InChIKey | TZHFPBFDDGWFLW-YHSAGPEESA-N |
| XLogP | 2.13 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.59 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze chloroform;(Z)-3-(2-methylpropanoylamino)but-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroform;(Z)-3-(2-methylpropanoylamino)but-2-enamide?
The IUPAC name of chloroform;(Z)-3-(2-methylpropanoylamino)but-2-enamide (CID 88774362) is chloroform;(Z)-3-(2-methylpropanoylamino)but-2-enamide.
What is the SMILES notation for chloroform;(Z)-3-(2-methylpropanoylamino)but-2-enamide?
The canonical SMILES for chloroform;(Z)-3-(2-methylpropanoylamino)but-2-enamide is C/C(=C/C(N)=O)NC(=O)C(C)C.ClC(Cl)Cl.
What is the InChIKey of chloroform;(Z)-3-(2-methylpropanoylamino)but-2-enamide?
The InChIKey is TZHFPBFDDGWFLW-YHSAGPEESA-N. The full InChI is InChI=1S/C8H14N2O2.CHCl3/c1-5(2)8(12)10-6(3)4-7(9)11;2-1(3)4/h4-5H,1-3H3,(H2,9,11)(H,10,12);1H/b6-4-;.
What are the key properties of chloroform;(Z)-3-(2-methylpropanoylamino)but-2-enamide?
chloroform;(Z)-3-(2-methylpropanoylamino)but-2-enamide has a molecular weight of 289.59 g/mol, XLogP of 2.13, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloroform;(Z)-3-(2-methylpropanoylamino)but-2-enamide is sourced from PubChem (CID 88774362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).