About 2-bromo-N',N'-diethylbutanediamide
2-bromo-N',N'-diethylbutanediamide (PubChem CID 88774369) has the molecular formula C8H15BrN2O2
and a molecular weight of 251.12 g/mol. Its IUPAC name is 2-bromo-N',N'-diethylbutanediamide.
Molecular Properties
| Compound Name | 2-bromo-N',N'-diethylbutanediamide |
| PubChem CID | 88774369 |
| Molecular Formula | C8H15BrN2O2 |
| Molecular Weight | 251.12 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 2-bromo-N',N'-diethylbutanediamide |
| SMILES | CCN(CC)C(=O)CC(Br)C(N)=O |
| InChI | InChI=1S/C8H15BrN2O2/c1-3-11(4-2)7(12)5-6(9)8(10)13/h6H,3-5H2,1-2H3,(H2,10,13) |
| InChIKey | BVAYLTYYSNCGEW-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.12 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N',N'-diethylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N',N'-diethylbutanediamide?
The IUPAC name of 2-bromo-N',N'-diethylbutanediamide (CID 88774369) is 2-bromo-N',N'-diethylbutanediamide.
What is the SMILES notation for 2-bromo-N',N'-diethylbutanediamide?
The canonical SMILES for 2-bromo-N',N'-diethylbutanediamide is CCN(CC)C(=O)CC(Br)C(N)=O.
What is the InChIKey of 2-bromo-N',N'-diethylbutanediamide?
The InChIKey is BVAYLTYYSNCGEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15BrN2O2/c1-3-11(4-2)7(12)5-6(9)8(10)13/h6H,3-5H2,1-2H3,(H2,10,13).
What are the key properties of 2-bromo-N',N'-diethylbutanediamide?
2-bromo-N',N'-diethylbutanediamide has a molecular weight of 251.12 g/mol, XLogP of 0.49, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N',N'-diethylbutanediamide is sourced from PubChem (CID 88774369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).