About 2,2-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)hexanedioic acid;isocyanic acid
2,2-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)hexanedioic acid;isocyanic acid (PubChem CID 88774646) has the molecular formula C21H31NO7
and a molecular weight of 409.48 g/mol. Its IUPAC name is 2,2-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)hexanedioic acid;isocyanic acid.
Molecular Properties
| Compound Name | 2,2-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)hexanedioic acid;isocyanic acid |
| PubChem CID | 88774646 |
| Molecular Formula | C21H31NO7 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 2,2-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)hexanedioic acid;isocyanic acid |
| SMILES | N=C=O.O=C(O)CCCC(CC1CCC2OC2C1)(CC1CCC2OC2C1)C(=O)O |
| InChI | InChI=1S/C20H30O6.CHNO/c21-18(22)2-1-7-20(19(23)24,10-12-3-5-14-16(8-12)25-14)11-13-4-6-15-17(9-13)26-15;2-1-3/h12-17H,1-11H2,(H,21,22)(H,23,24);2H |
| InChIKey | QRHKWKCHEKAHSS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 140.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)hexanedioic acid;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)hexanedioic acid;isocyanic acid?
The IUPAC name of 2,2-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)hexanedioic acid;isocyanic acid (CID 88774646) is 2,2-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)hexanedioic acid;isocyanic acid.
What is the SMILES notation for 2,2-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)hexanedioic acid;isocyanic acid?
The canonical SMILES for 2,2-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)hexanedioic acid;isocyanic acid is N=C=O.O=C(O)CCCC(CC1CCC2OC2C1)(CC1CCC2OC2C1)C(=O)O.
What is the InChIKey of 2,2-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)hexanedioic acid;isocyanic acid?
The InChIKey is QRHKWKCHEKAHSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30O6.CHNO/c21-18(22)2-1-7-20(19(23)24,10-12-3-5-14-16(8-12)25-14)11-13-4-6-15-17(9-13)26-15;2-1-3/h12-17H,1-11H2,(H,21,22)(H,23,24);2H.
What are the key properties of 2,2-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)hexanedioic acid;isocyanic acid?
2,2-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)hexanedioic acid;isocyanic acid has a molecular weight of 409.48 g/mol, XLogP of 3.13, 9 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)hexanedioic acid;isocyanic acid is sourced from PubChem (CID 88774646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).