About 1,2-oxazol-3-ylmethyl N-methyl-N-(1-sulfanylpropan-2-yl)carbamate
1,2-oxazol-3-ylmethyl N-methyl-N-(1-sulfanylpropan-2-yl)carbamate (PubChem CID 88774680) has the molecular formula C9H14N2O3S
and a molecular weight of 230.29 g/mol. Its IUPAC name is 1,2-oxazol-3-ylmethyl N-methyl-N-(1-sulfanylpropan-2-yl)carbamate.
Molecular Properties
| Compound Name | 1,2-oxazol-3-ylmethyl N-methyl-N-(1-sulfanylpropan-2-yl)carbamate |
| PubChem CID | 88774680 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 1,2-oxazol-3-ylmethyl N-methyl-N-(1-sulfanylpropan-2-yl)carbamate |
| SMILES | CC(CS)N(C)C(=O)OCc1ccon1 |
| InChI | InChI=1S/C9H14N2O3S/c1-7(6-15)11(2)9(12)13-5-8-3-4-14-10-8/h3-4,7,15H,5-6H2,1-2H3 |
| InChIKey | AAOPQVKVXOANNU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 55.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2-oxazol-3-ylmethyl N-methyl-N-(1-sulfanylpropan-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-oxazol-3-ylmethyl N-methyl-N-(1-sulfanylpropan-2-yl)carbamate?
The IUPAC name of 1,2-oxazol-3-ylmethyl N-methyl-N-(1-sulfanylpropan-2-yl)carbamate (CID 88774680) is 1,2-oxazol-3-ylmethyl N-methyl-N-(1-sulfanylpropan-2-yl)carbamate.
What is the SMILES notation for 1,2-oxazol-3-ylmethyl N-methyl-N-(1-sulfanylpropan-2-yl)carbamate?
The canonical SMILES for 1,2-oxazol-3-ylmethyl N-methyl-N-(1-sulfanylpropan-2-yl)carbamate is CC(CS)N(C)C(=O)OCc1ccon1.
What is the InChIKey of 1,2-oxazol-3-ylmethyl N-methyl-N-(1-sulfanylpropan-2-yl)carbamate?
The InChIKey is AAOPQVKVXOANNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3S/c1-7(6-15)11(2)9(12)13-5-8-3-4-14-10-8/h3-4,7,15H,5-6H2,1-2H3.
What are the key properties of 1,2-oxazol-3-ylmethyl N-methyl-N-(1-sulfanylpropan-2-yl)carbamate?
1,2-oxazol-3-ylmethyl N-methyl-N-(1-sulfanylpropan-2-yl)carbamate has a molecular weight of 230.29 g/mol, XLogP of 1.56, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-oxazol-3-ylmethyl N-methyl-N-(1-sulfanylpropan-2-yl)carbamate is sourced from PubChem (CID 88774680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).