About [(1S)-1-sulfooxyethyl] 7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate
[(1S)-1-sulfooxyethyl] 7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 88775248) has the molecular formula C9H11NO7S
and a molecular weight of 277.25 g/mol. Its IUPAC name is [(1S)-1-sulfooxyethyl] 7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
Molecular Properties
| Compound Name | [(1S)-1-sulfooxyethyl] 7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| PubChem CID | 88775248 |
| Molecular Formula | C9H11NO7S |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | [(1S)-1-sulfooxyethyl] 7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | C[C@@H](OC(=O)C1=CCC2CC(=O)N12)OS(=O)(=O)O |
| InChI | InChI=1S/C9H11NO7S/c1-5(17-18(13,14)15)16-9(12)7-3-2-6-4-8(11)10(6)7/h3,5-6H,2,4H2,1H3,(H,13,14,15)/t5-,6?/m0/s1 |
| InChIKey | KODMQSUBGAIYPR-ZBHICJROSA-N |
| XLogP | -0.42 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-1-sulfooxyethyl] 7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-sulfooxyethyl] 7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate?
The IUPAC name of [(1S)-1-sulfooxyethyl] 7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (CID 88775248) is [(1S)-1-sulfooxyethyl] 7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
What is the SMILES notation for [(1S)-1-sulfooxyethyl] 7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate?
The canonical SMILES for [(1S)-1-sulfooxyethyl] 7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate is C[C@@H](OC(=O)C1=CCC2CC(=O)N12)OS(=O)(=O)O.
What is the InChIKey of [(1S)-1-sulfooxyethyl] 7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate?
The InChIKey is KODMQSUBGAIYPR-ZBHICJROSA-N. The full InChI is InChI=1S/C9H11NO7S/c1-5(17-18(13,14)15)16-9(12)7-3-2-6-4-8(11)10(6)7/h3,5-6H,2,4H2,1H3,(H,13,14,15)/t5-,6?/m0/s1.
What are the key properties of [(1S)-1-sulfooxyethyl] 7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate?
[(1S)-1-sulfooxyethyl] 7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate has a molecular weight of 277.25 g/mol, XLogP of -0.42, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-sulfooxyethyl] 7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate is sourced from PubChem (CID 88775248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).