C13H23F3NO5PS — CID 88775602
ethyl 2-[dipropoxyphosphinothioylmethyl-(2,2,2-trifluoroacetyl)amino]acetate (PubChem CID 88775602) has the molecular formula C13H23F3NO5PS and a molecular weight of 393.36 g/mol. Its IUPAC name is ethyl 2-[dipropoxyphosphinothioylmethyl-(2,2,2-trifluoroacetyl)amino]acetate.
| Compound Name | ethyl 2-[dipropoxyphosphinothioylmethyl-(2,2,2-trifluoroacetyl)amino]acetate |
|---|---|
| PubChem CID | 88775602 |
| Molecular Formula | C13H23F3NO5PS |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | ethyl 2-[dipropoxyphosphinothioylmethyl-(2,2,2-trifluoroacetyl)amino]acetate |
| SMILES | CCCOP(=S)(CN(CC(=O)OCC)C(=O)C(F)(F)F)OCCC |
| InChI | InChI=1S/C13H23F3NO5PS/c1-4-7-21-23(24,22-8-5-2)10-17(9-11(18)20-6-3)12(19)13(14,15)16/h4-10H2,1-3H3 |
| InChIKey | STUIHSAOLQXJSE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|