About 9-isocyanatodec-1-ene;isocyanatoethane
9-isocyanatodec-1-ene;isocyanatoethane (PubChem CID 88775937) has the molecular formula C14H24N2O2
and a molecular weight of 252.36 g/mol. Its IUPAC name is 9-isocyanatodec-1-ene;isocyanatoethane.
Molecular Properties
| Compound Name | 9-isocyanatodec-1-ene;isocyanatoethane |
| PubChem CID | 88775937 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 9-isocyanatodec-1-ene;isocyanatoethane |
| SMILES | C=CCCCCCCC(C)N=C=O.CCN=C=O |
| InChI | InChI=1S/C11H19NO.C3H5NO/c1-3-4-5-6-7-8-9-11(2)12-10-13;1-2-4-3-5/h3,11H,1,4-9H2,2H3;2H2,1H3 |
| InChIKey | ANOJIBJFYPECQG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-isocyanatodec-1-ene;isocyanatoethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-isocyanatodec-1-ene;isocyanatoethane?
The IUPAC name of 9-isocyanatodec-1-ene;isocyanatoethane (CID 88775937) is 9-isocyanatodec-1-ene;isocyanatoethane.
What is the SMILES notation for 9-isocyanatodec-1-ene;isocyanatoethane?
The canonical SMILES for 9-isocyanatodec-1-ene;isocyanatoethane is C=CCCCCCCC(C)N=C=O.CCN=C=O.
What is the InChIKey of 9-isocyanatodec-1-ene;isocyanatoethane?
The InChIKey is ANOJIBJFYPECQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO.C3H5NO/c1-3-4-5-6-7-8-9-11(2)12-10-13;1-2-4-3-5/h3,11H,1,4-9H2,2H3;2H2,1H3.
What are the key properties of 9-isocyanatodec-1-ene;isocyanatoethane?
9-isocyanatodec-1-ene;isocyanatoethane has a molecular weight of 252.36 g/mol, XLogP of 3.58, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-isocyanatodec-1-ene;isocyanatoethane is sourced from PubChem (CID 88775937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).