About 2-chloro-4-(2-hydroxyethyl)phenol;furan-2-carbaldehyde
2-chloro-4-(2-hydroxyethyl)phenol;furan-2-carbaldehyde (PubChem CID 88776211) has the molecular formula C13H13ClO4
and a molecular weight of 268.70 g/mol. Its IUPAC name is 2-chloro-4-(2-hydroxyethyl)phenol;furan-2-carbaldehyde.
Molecular Properties
| Compound Name | 2-chloro-4-(2-hydroxyethyl)phenol;furan-2-carbaldehyde |
| PubChem CID | 88776211 |
| Molecular Formula | C13H13ClO4 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-chloro-4-(2-hydroxyethyl)phenol;furan-2-carbaldehyde |
| SMILES | O=Cc1ccco1.OCCc1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C8H9ClO2.C5H4O2/c9-7-5-6(3-4-10)1-2-8(7)11;6-4-5-2-1-3-7-5/h1-2,5,10-11H,3-4H2;1-4H |
| InChIKey | AJZPIVRUOMSPHD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-(2-hydroxyethyl)phenol;furan-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(2-hydroxyethyl)phenol;furan-2-carbaldehyde?
The IUPAC name of 2-chloro-4-(2-hydroxyethyl)phenol;furan-2-carbaldehyde (CID 88776211) is 2-chloro-4-(2-hydroxyethyl)phenol;furan-2-carbaldehyde.
What is the SMILES notation for 2-chloro-4-(2-hydroxyethyl)phenol;furan-2-carbaldehyde?
The canonical SMILES for 2-chloro-4-(2-hydroxyethyl)phenol;furan-2-carbaldehyde is O=Cc1ccco1.OCCc1ccc(O)c(Cl)c1.
What is the InChIKey of 2-chloro-4-(2-hydroxyethyl)phenol;furan-2-carbaldehyde?
The InChIKey is AJZPIVRUOMSPHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClO2.C5H4O2/c9-7-5-6(3-4-10)1-2-8(7)11;6-4-5-2-1-3-7-5/h1-2,5,10-11H,3-4H2;1-4H.
What are the key properties of 2-chloro-4-(2-hydroxyethyl)phenol;furan-2-carbaldehyde?
2-chloro-4-(2-hydroxyethyl)phenol;furan-2-carbaldehyde has a molecular weight of 268.70 g/mol, XLogP of 2.67, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(2-hydroxyethyl)phenol;furan-2-carbaldehyde is sourced from PubChem (CID 88776211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).