About 4-methyl-2-nitroaniline;3-oxo-N-phenylbutanamide
4-methyl-2-nitroaniline;3-oxo-N-phenylbutanamide (PubChem CID 88776406) has the molecular formula C17H19N3O4
and a molecular weight of 329.36 g/mol. Its IUPAC name is 4-methyl-2-nitroaniline;3-oxo-N-phenylbutanamide.
Molecular Properties
| Compound Name | 4-methyl-2-nitroaniline;3-oxo-N-phenylbutanamide |
| PubChem CID | 88776406 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 4-methyl-2-nitroaniline;3-oxo-N-phenylbutanamide |
| SMILES | CC(=O)CC(=O)Nc1ccccc1.Cc1ccc(N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H11NO2.C7H8N2O2/c1-8(12)7-10(13)11-9-5-3-2-4-6-9;1-5-2-3-6(8)7(4-5)9(10)11/h2-6H,7H2,1H3,(H,11,13);2-4H,8H2,1H3 |
| InChIKey | UIEUQMPFLCHKAG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2-nitroaniline;3-oxo-N-phenylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-nitroaniline;3-oxo-N-phenylbutanamide?
The IUPAC name of 4-methyl-2-nitroaniline;3-oxo-N-phenylbutanamide (CID 88776406) is 4-methyl-2-nitroaniline;3-oxo-N-phenylbutanamide.
What is the SMILES notation for 4-methyl-2-nitroaniline;3-oxo-N-phenylbutanamide?
The canonical SMILES for 4-methyl-2-nitroaniline;3-oxo-N-phenylbutanamide is CC(=O)CC(=O)Nc1ccccc1.Cc1ccc(N)c([N+](=O)[O-])c1.
What is the InChIKey of 4-methyl-2-nitroaniline;3-oxo-N-phenylbutanamide?
The InChIKey is UIEUQMPFLCHKAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2.C7H8N2O2/c1-8(12)7-10(13)11-9-5-3-2-4-6-9;1-5-2-3-6(8)7(4-5)9(10)11/h2-6H,7H2,1H3,(H,11,13);2-4H,8H2,1H3.
What are the key properties of 4-methyl-2-nitroaniline;3-oxo-N-phenylbutanamide?
4-methyl-2-nitroaniline;3-oxo-N-phenylbutanamide has a molecular weight of 329.36 g/mol, XLogP of 3.09, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-nitroaniline;3-oxo-N-phenylbutanamide is sourced from PubChem (CID 88776406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).