About 4-diazo-N-ethyl-6-methylcyclohexa-1,5-dien-1-amine tetrafluoroborate
4-diazo-N-ethyl-6-methylcyclohexa-1,5-dien-1-amine tetrafluoroborate (PubChem CID 88777070) has the molecular formula C9H13BF4N3-
and a molecular weight of 250.03 g/mol. Its IUPAC name is 4-diazo-N-ethyl-6-methylcyclohexa-1,5-dien-1-amine tetrafluoroborate.
Molecular Properties
| Compound Name | 4-diazo-N-ethyl-6-methylcyclohexa-1,5-dien-1-amine tetrafluoroborate |
| PubChem CID | 88777070 |
| Molecular Formula | C9H13BF4N3- |
| Molecular Weight | 250.03 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 4-diazo-N-ethyl-6-methylcyclohexa-1,5-dien-1-amine tetrafluoroborate |
| SMILES | CCNC1=CCC(=[N+]=[N-])C=C1C.F[B-](F)(F)F |
| InChI | InChI=1S/C9H13N3.BF4/c1-3-11-9-5-4-8(12-10)6-7(9)2;2-1(3,4)5/h5-6,11H,3-4H2,1-2H3;/q;-1 |
| InChIKey | NQPXRJPPDFDKEO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 48.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.03 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-diazo-N-ethyl-6-methylcyclohexa-1,5-dien-1-amine tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-diazo-N-ethyl-6-methylcyclohexa-1,5-dien-1-amine tetrafluoroborate?
The IUPAC name of 4-diazo-N-ethyl-6-methylcyclohexa-1,5-dien-1-amine tetrafluoroborate (CID 88777070) is 4-diazo-N-ethyl-6-methylcyclohexa-1,5-dien-1-amine tetrafluoroborate.
What is the SMILES notation for 4-diazo-N-ethyl-6-methylcyclohexa-1,5-dien-1-amine tetrafluoroborate?
The canonical SMILES for 4-diazo-N-ethyl-6-methylcyclohexa-1,5-dien-1-amine tetrafluoroborate is CCNC1=CCC(=[N+]=[N-])C=C1C.F[B-](F)(F)F.
What is the InChIKey of 4-diazo-N-ethyl-6-methylcyclohexa-1,5-dien-1-amine tetrafluoroborate?
The InChIKey is NQPXRJPPDFDKEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3.BF4/c1-3-11-9-5-4-8(12-10)6-7(9)2;2-1(3,4)5/h5-6,11H,3-4H2,1-2H3;/q;-1.
What are the key properties of 4-diazo-N-ethyl-6-methylcyclohexa-1,5-dien-1-amine tetrafluoroborate?
4-diazo-N-ethyl-6-methylcyclohexa-1,5-dien-1-amine tetrafluoroborate has a molecular weight of 250.03 g/mol, XLogP of 2.80, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-diazo-N-ethyl-6-methylcyclohexa-1,5-dien-1-amine tetrafluoroborate is sourced from PubChem (CID 88777070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).