C15H23NO6 — CID 88777202
6-[4-(dihydroxyamino)-3-methylbutanoyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione (PubChem CID 88777202) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is 6-[4-(dihydroxyamino)-3-methylbutanoyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione.
| Compound Name | 6-[4-(dihydroxyamino)-3-methylbutanoyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 88777202 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 6-[4-(dihydroxyamino)-3-methylbutanoyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
| SMILES | CC(CC(=O)C1C(=O)C(C)(C)C(=O)C(C)(C)C1=O)CN(O)O |
| InChI | InChI=1S/C15H23NO6/c1-8(7-16(21)22)6-9(17)10-11(18)14(2,3)13(20)15(4,5)12(10)19/h8,10,21-22H,6-7H2,1-5H3 |
| InChIKey | HEDBPTWJNINBCH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|