C18H8N2O15 — CID 88777503
4-(2,4-dicarboxy-5-nitrobenzoyl)oxycarbonyl-6-nitrobenzene-1,3-dicarboxylic acid (PubChem CID 88777503) has the molecular formula C18H8N2O15 and a molecular weight of 492.26 g/mol. Its IUPAC name is 4-(2,4-dicarboxy-5-nitrobenzoyl)oxycarbonyl-6-nitrobenzene-1,3-dicarboxylic acid.
| Compound Name | 4-(2,4-dicarboxy-5-nitrobenzoyl)oxycarbonyl-6-nitrobenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 88777503 |
| Molecular Formula | C18H8N2O15 |
| Molecular Weight | 492.26 g/mol |
| Exact Mass | 491.99 |
| IUPAC Name | 4-(2,4-dicarboxy-5-nitrobenzoyl)oxycarbonyl-6-nitrobenzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)c([N+](=O)[O-])cc1C(=O)OC(=O)c1cc([N+](=O)[O-])c(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C18H8N2O15/c21-13(22)5-1-9(15(25)26)11(19(31)32)3-7(5)17(29)35-18(30)8-4-12(20(33)34)10(16(27)28)2-6(8)14(23)24/h1-4H,(H,21,22)(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | BBWBNAWJJOUKNC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 278.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|