C13H24O6 — CID 88777785
2,6,9-trihydroperoxy-2,6,9-trimethyldec-3-yne (PubChem CID 88777785) has the molecular formula C13H24O6 and a molecular weight of 276.33 g/mol. Its IUPAC name is 2,6,9-trihydroperoxy-2,6,9-trimethyldec-3-yne.
| Compound Name | 2,6,9-trihydroperoxy-2,6,9-trimethyldec-3-yne |
|---|---|
| PubChem CID | 88777785 |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2,6,9-trihydroperoxy-2,6,9-trimethyldec-3-yne |
| SMILES | CC(C)(C#CCC(C)(CCC(C)(C)OO)OO)OO |
| InChI | InChI=1S/C13H24O6/c1-11(2,17-14)7-6-8-13(5,19-16)10-9-12(3,4)18-15/h14-16H,8-10H2,1-5H3 |
| InChIKey | VRMNWPQAOPPWOE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|