About 6-amino-6-[(2-bromoacetyl)amino]cyclohexa-2,4-diene-1-sulfonic acid
6-amino-6-[(2-bromoacetyl)amino]cyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 88778195) has the molecular formula C8H11BrN2O4S
and a molecular weight of 311.16 g/mol. Its IUPAC name is 6-amino-6-[(2-bromoacetyl)amino]cyclohexa-2,4-diene-1-sulfonic acid.
Molecular Properties
| Compound Name | 6-amino-6-[(2-bromoacetyl)amino]cyclohexa-2,4-diene-1-sulfonic acid |
| PubChem CID | 88778195 |
| Molecular Formula | C8H11BrN2O4S |
| Molecular Weight | 311.16 g/mol |
| Exact Mass | 309.96 |
| IUPAC Name | 6-amino-6-[(2-bromoacetyl)amino]cyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | NC1(NC(=O)CBr)C=CC=CC1S(=O)(=O)O |
| InChI | InChI=1S/C8H11BrN2O4S/c9-5-7(12)11-8(10)4-2-1-3-6(8)16(13,14)15/h1-4,6H,5,10H2,(H,11,12)(H,13,14,15) |
| InChIKey | NGSJHBWCBDKLMB-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.16 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-6-[(2-bromoacetyl)amino]cyclohexa-2,4-diene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-6-[(2-bromoacetyl)amino]cyclohexa-2,4-diene-1-sulfonic acid?
The IUPAC name of 6-amino-6-[(2-bromoacetyl)amino]cyclohexa-2,4-diene-1-sulfonic acid (CID 88778195) is 6-amino-6-[(2-bromoacetyl)amino]cyclohexa-2,4-diene-1-sulfonic acid.
What is the SMILES notation for 6-amino-6-[(2-bromoacetyl)amino]cyclohexa-2,4-diene-1-sulfonic acid?
The canonical SMILES for 6-amino-6-[(2-bromoacetyl)amino]cyclohexa-2,4-diene-1-sulfonic acid is NC1(NC(=O)CBr)C=CC=CC1S(=O)(=O)O.
What is the InChIKey of 6-amino-6-[(2-bromoacetyl)amino]cyclohexa-2,4-diene-1-sulfonic acid?
The InChIKey is NGSJHBWCBDKLMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BrN2O4S/c9-5-7(12)11-8(10)4-2-1-3-6(8)16(13,14)15/h1-4,6H,5,10H2,(H,11,12)(H,13,14,15).
What are the key properties of 6-amino-6-[(2-bromoacetyl)amino]cyclohexa-2,4-diene-1-sulfonic acid?
6-amino-6-[(2-bromoacetyl)amino]cyclohexa-2,4-diene-1-sulfonic acid has a molecular weight of 311.16 g/mol, XLogP of -0.47, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-6-[(2-bromoacetyl)amino]cyclohexa-2,4-diene-1-sulfonic acid is sourced from PubChem (CID 88778195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).