C12H18O2 — CID 88778593
cis-(1R,3R)-2,2-dimethyl-3-(2-methylpenta-1,3-dienyl)cyclopropane-1-carboxylic acid (PubChem CID 88778593) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is cis-(1R,3R)-2,2-dimethyl-3-(2-methylpenta-1,3-dienyl)cyclopropane-1-carboxylic acid.
| Compound Name | cis-(1R,3R)-2,2-dimethyl-3-(2-methylpenta-1,3-dienyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 88778593 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | cis-(1R,3R)-2,2-dimethyl-3-(2-methylpenta-1,3-dienyl)cyclopropane-1-carboxylic acid |
| SMILES | CC=CC(C)=C[C@@H]1[C@@H](C(=O)O)C1(C)C |
| InChI | InChI=1S/C12H18O2/c1-5-6-8(2)7-9-10(11(13)14)12(9,3)4/h5-7,9-10H,1-4H3,(H,13,14)/t9-,10+/m1/s1 |
| InChIKey | KARJDWVHWYFICE-ZJUUUORDSA-N |
| XLogP | 2.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|