C10H14F3NO5S — CID 88778796
3-[(2S)-pyrrolidine-2-carbonyl]sulfanylpropanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 88778796) has the molecular formula C10H14F3NO5S and a molecular weight of 317.29 g/mol. Its IUPAC name is 3-[(2S)-pyrrolidine-2-carbonyl]sulfanylpropanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[(2S)-pyrrolidine-2-carbonyl]sulfanylpropanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 88778796 |
| Molecular Formula | C10H14F3NO5S |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 3-[(2S)-pyrrolidine-2-carbonyl]sulfanylpropanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CCSC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C8H13NO3S.C2HF3O2/c10-7(11)3-5-13-8(12)6-2-1-4-9-6;3-2(4,5)1(6)7/h6,9H,1-5H2,(H,10,11);(H,6,7)/t6-;/m0./s1 |
| InChIKey | LNCHYXHQSGFADX-RGMNGODLSA-N |
| XLogP | 1.11 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|