About 7-ethylacridine-3,9-diamine;2-hydroxypropanoic acid
7-ethylacridine-3,9-diamine;2-hydroxypropanoic acid (PubChem CID 88778848) has the molecular formula C18H21N3O3
and a molecular weight of 327.38 g/mol. Its IUPAC name is 7-ethylacridine-3,9-diamine;2-hydroxypropanoic acid.
Molecular Properties
| Compound Name | 7-ethylacridine-3,9-diamine;2-hydroxypropanoic acid |
| PubChem CID | 88778848 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 7-ethylacridine-3,9-diamine;2-hydroxypropanoic acid |
| SMILES | CC(O)C(=O)O.CCc1ccc2nc3cc(N)ccc3c(N)c2c1 |
| InChI | InChI=1S/C15H15N3.C3H6O3/c1-2-9-3-6-13-12(7-9)15(17)11-5-4-10(16)8-14(11)18-13;1-2(4)3(5)6/h3-8H,2,16H2,1H3,(H2,17,18);2,4H,1H3,(H,5,6) |
| InChIKey | OAYBUJOPOUBJLY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 7-ethylacridine-3,9-diamine;2-hydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethylacridine-3,9-diamine;2-hydroxypropanoic acid?
The IUPAC name of 7-ethylacridine-3,9-diamine;2-hydroxypropanoic acid (CID 88778848) is 7-ethylacridine-3,9-diamine;2-hydroxypropanoic acid.
What is the SMILES notation for 7-ethylacridine-3,9-diamine;2-hydroxypropanoic acid?
The canonical SMILES for 7-ethylacridine-3,9-diamine;2-hydroxypropanoic acid is CC(O)C(=O)O.CCc1ccc2nc3cc(N)ccc3c(N)c2c1.
What is the InChIKey of 7-ethylacridine-3,9-diamine;2-hydroxypropanoic acid?
The InChIKey is OAYBUJOPOUBJLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3.C3H6O3/c1-2-9-3-6-13-12(7-9)15(17)11-5-4-10(16)8-14(11)18-13;1-2(4)3(5)6/h3-8H,2,16H2,1H3,(H2,17,18);2,4H,1H3,(H,5,6).
What are the key properties of 7-ethylacridine-3,9-diamine;2-hydroxypropanoic acid?
7-ethylacridine-3,9-diamine;2-hydroxypropanoic acid has a molecular weight of 327.38 g/mol, XLogP of 2.57, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethylacridine-3,9-diamine;2-hydroxypropanoic acid is sourced from PubChem (CID 88778848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).