C24H43NO — CID 88779249
(2E,6Z,10E)-3,11,15-trimethyl-7-[(2-methylpropylamino)methyl]hexadeca-2,6,10,14-tetraen-1-ol (PubChem CID 88779249) has the molecular formula C24H43NO and a molecular weight of 361.61 g/mol. Its IUPAC name is (2E,6Z,10E)-3,11,15-trimethyl-7-[(2-methylpropylamino)methyl]hexadeca-2,6,10,14-tetraen-1-ol.
| Compound Name | (2E,6Z,10E)-3,11,15-trimethyl-7-[(2-methylpropylamino)methyl]hexadeca-2,6,10,14-tetraen-1-ol |
|---|---|
| PubChem CID | 88779249 |
| Molecular Formula | C24H43NO |
| Molecular Weight | 361.61 g/mol |
| Exact Mass | 361.33 |
| IUPAC Name | (2E,6Z,10E)-3,11,15-trimethyl-7-[(2-methylpropylamino)methyl]hexadeca-2,6,10,14-tetraen-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(=C/CC/C(C)=C/CO)CNCC(C)C |
| InChI | InChI=1S/C24H43NO/c1-20(2)10-7-11-22(5)12-8-14-24(19-25-18-21(3)4)15-9-13-23(6)16-17-26/h10,12,15-16,21,25-26H,7-9,11,13-14,17-19H2,1-6H3/b22-12+,23-16+,24-15- |
| InChIKey | OTQMFAPWJMTOHK-CAPVSFSXSA-N |
| XLogP | 6.35 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.61 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|