C21H39NO — CID 88779302
(2E,6Z)-7-[[di(propan-2-yl)amino]methyl]-3,11-dimethyldodeca-2,6,10-trien-1-ol (PubChem CID 88779302) has the molecular formula C21H39NO and a molecular weight of 321.55 g/mol. Its IUPAC name is (2E,6Z)-7-[[di(propan-2-yl)amino]methyl]-3,11-dimethyldodeca-2,6,10-trien-1-ol.
| Compound Name | (2E,6Z)-7-[[di(propan-2-yl)amino]methyl]-3,11-dimethyldodeca-2,6,10-trien-1-ol |
|---|---|
| PubChem CID | 88779302 |
| Molecular Formula | C21H39NO |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 321.30 |
| IUPAC Name | (2E,6Z)-7-[[di(propan-2-yl)amino]methyl]-3,11-dimethyldodeca-2,6,10-trien-1-ol |
| SMILES | CC(C)=CCC/C(=C/CC/C(C)=C/CO)CN(C(C)C)C(C)C |
| InChI | InChI=1S/C21H39NO/c1-17(2)10-8-12-21(13-9-11-20(7)14-15-23)16-22(18(3)4)19(5)6/h10,13-14,18-19,23H,8-9,11-12,15-16H2,1-7H3/b20-14+,21-13- |
| InChIKey | UDUSVQNDHBFMGV-GYICUJRQSA-N |
| XLogP | 5.50 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|