C24H41NO2 — CID 88779340
(2E,6Z,10E)-N,N-diethyl-7-(hydroxymethyl)-3,11,15-trimethylhexadeca-2,6,10,14-tetraenamide (PubChem CID 88779340) has the molecular formula C24H41NO2 and a molecular weight of 375.60 g/mol. Its IUPAC name is (2E,6Z,10E)-N,N-diethyl-7-(hydroxymethyl)-3,11,15-trimethylhexadeca-2,6,10,14-tetraenamide.
| Compound Name | (2E,6Z,10E)-N,N-diethyl-7-(hydroxymethyl)-3,11,15-trimethylhexadeca-2,6,10,14-tetraenamide |
|---|---|
| PubChem CID | 88779340 |
| Molecular Formula | C24H41NO2 |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 375.31 |
| IUPAC Name | (2E,6Z,10E)-N,N-diethyl-7-(hydroxymethyl)-3,11,15-trimethylhexadeca-2,6,10,14-tetraenamide |
| SMILES | CCN(CC)C(=O)/C=C(\C)CC/C=C(\CO)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C24H41NO2/c1-7-25(8-2)24(27)18-22(6)15-11-17-23(19-26)16-10-14-21(5)13-9-12-20(3)4/h12,14,17-18,26H,7-11,13,15-16,19H2,1-6H3/b21-14+,22-18+,23-17- |
| InChIKey | BAENWRWJWJWGRS-VJLIFRLVSA-N |
| XLogP | 5.97 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|