C15H10Cl5NO — CID 88779627
2,3,4,5,6-pentachloro-N-(oxiran-2-ylmethyl)-N-phenylaniline (PubChem CID 88779627) has the molecular formula C15H10Cl5NO and a molecular weight of 397.52 g/mol. Its IUPAC name is 2,3,4,5,6-pentachloro-N-(oxiran-2-ylmethyl)-N-phenylaniline.
| Compound Name | 2,3,4,5,6-pentachloro-N-(oxiran-2-ylmethyl)-N-phenylaniline |
|---|---|
| PubChem CID | 88779627 |
| Molecular Formula | C15H10Cl5NO |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 394.92 |
| IUPAC Name | 2,3,4,5,6-pentachloro-N-(oxiran-2-ylmethyl)-N-phenylaniline |
| SMILES | Clc1c(Cl)c(Cl)c(N(CC2CO2)c2ccccc2)c(Cl)c1Cl |
| InChI | InChI=1S/C15H10Cl5NO/c16-10-11(17)13(19)15(14(20)12(10)18)21(6-9-7-22-9)8-4-2-1-3-5-8/h1-5,9H,6-7H2 |
| InChIKey | SETAZJWQPLKZCN-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 15.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|