C10H8N4O3S3 — CID 88779901
(6S)-7-amino-7-methanethioyl-8-oxo-3-(1,3,4-thiadiazol-2-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88779901) has the molecular formula C10H8N4O3S3 and a molecular weight of 328.40 g/mol. Its IUPAC name is (6S)-7-amino-7-methanethioyl-8-oxo-3-(1,3,4-thiadiazol-2-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-amino-7-methanethioyl-8-oxo-3-(1,3,4-thiadiazol-2-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88779901 |
| Molecular Formula | C10H8N4O3S3 |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | (6S)-7-amino-7-methanethioyl-8-oxo-3-(1,3,4-thiadiazol-2-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | NC1(C=S)C(=O)N2C(C(=O)O)=C(c3nncs3)CS[C@H]21 |
| InChI | InChI=1S/C10H8N4O3S3/c11-10(2-18)8(17)14-5(7(15)16)4(1-19-9(10)14)6-13-12-3-20-6/h2-3,9H,1,11H2,(H,15,16)/t9-,10?/m0/s1 |
| InChIKey | XYRAFSKPCSABAV-RGURZIINSA-N |
| XLogP | -0.05 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|