About (Z)-3,4-dibromo-6-methylhept-2-ene
(Z)-3,4-dibromo-6-methylhept-2-ene (PubChem CID 88780282) has the molecular formula C8H14Br2
and a molecular weight of 270.01 g/mol. Its IUPAC name is (Z)-3,4-dibromo-6-methylhept-2-ene.
Molecular Properties
| Compound Name | (Z)-3,4-dibromo-6-methylhept-2-ene |
| PubChem CID | 88780282 |
| Molecular Formula | C8H14Br2 |
| Molecular Weight | 270.01 g/mol |
| Exact Mass | 267.95 |
| IUPAC Name | (Z)-3,4-dibromo-6-methylhept-2-ene |
| SMILES | C/C=C(\Br)C(Br)CC(C)C |
| InChI | InChI=1S/C8H14Br2/c1-4-7(9)8(10)5-6(2)3/h4,6,8H,5H2,1-3H3/b7-4- |
| InChIKey | MBKQLBKSESXRFQ-DAXSKMNVSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.01 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3,4-dibromo-6-methylhept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3,4-dibromo-6-methylhept-2-ene?
The IUPAC name of (Z)-3,4-dibromo-6-methylhept-2-ene (CID 88780282) is (Z)-3,4-dibromo-6-methylhept-2-ene.
What is the SMILES notation for (Z)-3,4-dibromo-6-methylhept-2-ene?
The canonical SMILES for (Z)-3,4-dibromo-6-methylhept-2-ene is C/C=C(\Br)C(Br)CC(C)C.
What is the InChIKey of (Z)-3,4-dibromo-6-methylhept-2-ene?
The InChIKey is MBKQLBKSESXRFQ-DAXSKMNVSA-N. The full InChI is InChI=1S/C8H14Br2/c1-4-7(9)8(10)5-6(2)3/h4,6,8H,5H2,1-3H3/b7-4-.
What are the key properties of (Z)-3,4-dibromo-6-methylhept-2-ene?
(Z)-3,4-dibromo-6-methylhept-2-ene has a molecular weight of 270.01 g/mol, XLogP of 4.09, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3,4-dibromo-6-methylhept-2-ene is sourced from PubChem (CID 88780282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).