About azane;[3-methyl-3-(pentanoylamino)butyl] acetate
azane;[3-methyl-3-(pentanoylamino)butyl] acetate (PubChem CID 88780374) has the molecular formula C12H26N2O3
and a molecular weight of 246.35 g/mol. Its IUPAC name is azane;[3-methyl-3-(pentanoylamino)butyl] acetate.
Molecular Properties
| Compound Name | azane;[3-methyl-3-(pentanoylamino)butyl] acetate |
| PubChem CID | 88780374 |
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | azane;[3-methyl-3-(pentanoylamino)butyl] acetate |
| SMILES | CCCCC(=O)NC(C)(C)CCOC(C)=O.N |
| InChI | InChI=1S/C12H23NO3.H3N/c1-5-6-7-11(15)13-12(3,4)8-9-16-10(2)14;/h5-9H2,1-4H3,(H,13,15);1H3 |
| InChIKey | TVAAHMZLBZTKSN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 90.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;[3-methyl-3-(pentanoylamino)butyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;[3-methyl-3-(pentanoylamino)butyl] acetate?
The IUPAC name of azane;[3-methyl-3-(pentanoylamino)butyl] acetate (CID 88780374) is azane;[3-methyl-3-(pentanoylamino)butyl] acetate.
What is the SMILES notation for azane;[3-methyl-3-(pentanoylamino)butyl] acetate?
The canonical SMILES for azane;[3-methyl-3-(pentanoylamino)butyl] acetate is CCCCC(=O)NC(C)(C)CCOC(C)=O.N.
What is the InChIKey of azane;[3-methyl-3-(pentanoylamino)butyl] acetate?
The InChIKey is TVAAHMZLBZTKSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3.H3N/c1-5-6-7-11(15)13-12(3,4)8-9-16-10(2)14;/h5-9H2,1-4H3,(H,13,15);1H3.
What are the key properties of azane;[3-methyl-3-(pentanoylamino)butyl] acetate?
azane;[3-methyl-3-(pentanoylamino)butyl] acetate has a molecular weight of 246.35 g/mol, XLogP of 2.19, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;[3-methyl-3-(pentanoylamino)butyl] acetate is sourced from PubChem (CID 88780374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).