About 2,3-diimino-N,N-dimethylpentan-1-amine
2,3-diimino-N,N-dimethylpentan-1-amine (PubChem CID 88780504) has the molecular formula C7H15N3
and a molecular weight of 141.22 g/mol. Its IUPAC name is 2,3-diimino-N,N-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | 2,3-diimino-N,N-dimethylpentan-1-amine |
| PubChem CID | 88780504 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | 2,3-diimino-N,N-dimethylpentan-1-amine |
| SMILES | [H]/N=C(CC)/C(CN(C)C)=N/[H] |
| InChI | InChI=1S/C7H15N3/c1-4-6(8)7(9)5-10(2)3/h8-9H,4-5H2,1-3H3/b8-6+,9-7+ |
| InChIKey | BMFARCBZVDYAGT-CDJQDVQCSA-N |
| XLogP | 1.00 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diimino-N,N-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diimino-N,N-dimethylpentan-1-amine?
The IUPAC name of 2,3-diimino-N,N-dimethylpentan-1-amine (CID 88780504) is 2,3-diimino-N,N-dimethylpentan-1-amine.
What is the SMILES notation for 2,3-diimino-N,N-dimethylpentan-1-amine?
The canonical SMILES for 2,3-diimino-N,N-dimethylpentan-1-amine is [H]/N=C(CC)/C(CN(C)C)=N/[H].
What is the InChIKey of 2,3-diimino-N,N-dimethylpentan-1-amine?
The InChIKey is BMFARCBZVDYAGT-CDJQDVQCSA-N. The full InChI is InChI=1S/C7H15N3/c1-4-6(8)7(9)5-10(2)3/h8-9H,4-5H2,1-3H3/b8-6+,9-7+.
What are the key properties of 2,3-diimino-N,N-dimethylpentan-1-amine?
2,3-diimino-N,N-dimethylpentan-1-amine has a molecular weight of 141.22 g/mol, XLogP of 1.00, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diimino-N,N-dimethylpentan-1-amine is sourced from PubChem (CID 88780504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).