C11H16O4 — CID 88780528
(3'aS,6'aR)-2'-hydroxyspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carbaldehyde (PubChem CID 88780528) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is (3'aS,6'aR)-2'-hydroxyspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carbaldehyde.
| Compound Name | (3'aS,6'aR)-2'-hydroxyspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carbaldehyde |
|---|---|
| PubChem CID | 88780528 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (3'aS,6'aR)-2'-hydroxyspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carbaldehyde |
| SMILES | O=CC1C(O)C[C@H]2CC3(C[C@@H]12)OCCO3 |
| InChI | InChI=1S/C11H16O4/c12-6-9-8-5-11(14-1-2-15-11)4-7(8)3-10(9)13/h6-10,13H,1-5H2/t7-,8+,9?,10?/m0/s1 |
| InChIKey | CCQAREGPOXVRDQ-AFWXGSBKSA-N |
| XLogP | 0.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|