C25H22F6N4O — CID 88780825
1-[2-[2-[1,5-bis[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-ylidene]hydrazinyl]-5,6-dihydro-4H-pyrimidin-1-yl]ethanone (PubChem CID 88780825) has the molecular formula C25H22F6N4O and a molecular weight of 508.47 g/mol. Its IUPAC name is 1-[2-[2-[1,5-bis[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-ylidene]hydrazinyl]-5,6-dihydro-4H-pyrimidin-1-yl]ethanone.
| Compound Name | 1-[2-[2-[1,5-bis[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-ylidene]hydrazinyl]-5,6-dihydro-4H-pyrimidin-1-yl]ethanone |
|---|---|
| PubChem CID | 88780825 |
| Molecular Formula | C25H22F6N4O |
| Molecular Weight | 508.47 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 1-[2-[2-[1,5-bis[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-ylidene]hydrazinyl]-5,6-dihydro-4H-pyrimidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN=C1NN=C(C=Cc1ccc(C(F)(F)F)cc1)C=Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H22F6N4O/c1-17(36)35-16-2-15-32-23(35)34-33-22(13-7-18-3-9-20(10-4-18)24(26,27)28)14-8-19-5-11-21(12-6-19)25(29,30)31/h3-14H,2,15-16H2,1H3,(H,32,34) |
| InChIKey | PSWFLJZJDHXLID-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.47 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|