About barium(2+);2-butoxyethyl phosphite
barium(2+);2-butoxyethyl phosphite (PubChem CID 88780891) has the molecular formula C6H13BaO4P
and a molecular weight of 317.47 g/mol. Its IUPAC name is barium(2+);2-butoxyethyl phosphite.
Molecular Properties
| Compound Name | barium(2+);2-butoxyethyl phosphite |
| PubChem CID | 88780891 |
| Molecular Formula | C6H13BaO4P |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.96 |
| IUPAC Name | barium(2+);2-butoxyethyl phosphite |
| SMILES | CCCCOCCOP([O-])[O-].[Ba+2] |
| InChI | InChI=1S/C6H13O4P.Ba/c1-2-3-4-9-5-6-10-11(7)8;/h2-6H2,1H3;/q-2;+2 |
| InChIKey | GUSUPFVXRQSZSX-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 64.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);2-butoxyethyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);2-butoxyethyl phosphite?
The IUPAC name of barium(2+);2-butoxyethyl phosphite (CID 88780891) is barium(2+);2-butoxyethyl phosphite.
What is the SMILES notation for barium(2+);2-butoxyethyl phosphite?
The canonical SMILES for barium(2+);2-butoxyethyl phosphite is CCCCOCCOP([O-])[O-].[Ba+2].
What is the InChIKey of barium(2+);2-butoxyethyl phosphite?
The InChIKey is GUSUPFVXRQSZSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13O4P.Ba/c1-2-3-4-9-5-6-10-11(7)8;/h2-6H2,1H3;/q-2;+2.
What are the key properties of barium(2+);2-butoxyethyl phosphite?
barium(2+);2-butoxyethyl phosphite has a molecular weight of 317.47 g/mol, XLogP of -0.61, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);2-butoxyethyl phosphite is sourced from PubChem (CID 88780891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).