About 7-methoxy-1',3-dimethyl-1'-oxidospiro[5H-benzo[b][1]benzothiepine-6,4'-piperidin-1-ium]
7-methoxy-1',3-dimethyl-1'-oxidospiro[5H-benzo[b][1]benzothiepine-6,4'-piperidin-1-ium] (PubChem CID 88781147) has the molecular formula C21H25NO2S
and a molecular weight of 355.50 g/mol. Its IUPAC name is 7-methoxy-1',3-dimethyl-1'-oxidospiro[5H-benzo[b][1]benzothiepine-6,4'-piperidin-1-ium].
Molecular Properties
| Compound Name | 7-methoxy-1',3-dimethyl-1'-oxidospiro[5H-benzo[b][1]benzothiepine-6,4'-piperidin-1-ium] |
| PubChem CID | 88781147 |
| Molecular Formula | C21H25NO2S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 7-methoxy-1',3-dimethyl-1'-oxidospiro[5H-benzo[b][1]benzothiepine-6,4'-piperidin-1-ium] |
| SMILES | COc1cccc2c1C1(CC[N+](C)([O-])CC1)Cc1cc(C)ccc1S2 |
| InChI | InChI=1S/C21H25NO2S/c1-15-7-8-18-16(13-15)14-21(9-11-22(2,23)12-10-21)20-17(24-3)5-4-6-19(20)25-18/h4-8,13H,9-12,14H2,1-3H3 |
| InChIKey | GEJKFCSFLUKRQY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 7-methoxy-1',3-dimethyl-1'-oxidospiro[5H-benzo[b][1]benzothiepine-6,4'-piperidin-1-ium] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-1',3-dimethyl-1'-oxidospiro[5H-benzo[b][1]benzothiepine-6,4'-piperidin-1-ium]?
The IUPAC name of 7-methoxy-1',3-dimethyl-1'-oxidospiro[5H-benzo[b][1]benzothiepine-6,4'-piperidin-1-ium] (CID 88781147) is 7-methoxy-1',3-dimethyl-1'-oxidospiro[5H-benzo[b][1]benzothiepine-6,4'-piperidin-1-ium].
What is the SMILES notation for 7-methoxy-1',3-dimethyl-1'-oxidospiro[5H-benzo[b][1]benzothiepine-6,4'-piperidin-1-ium]?
The canonical SMILES for 7-methoxy-1',3-dimethyl-1'-oxidospiro[5H-benzo[b][1]benzothiepine-6,4'-piperidin-1-ium] is COc1cccc2c1C1(CC[N+](C)([O-])CC1)Cc1cc(C)ccc1S2.
What is the InChIKey of 7-methoxy-1',3-dimethyl-1'-oxidospiro[5H-benzo[b][1]benzothiepine-6,4'-piperidin-1-ium]?
The InChIKey is GEJKFCSFLUKRQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO2S/c1-15-7-8-18-16(13-15)14-21(9-11-22(2,23)12-10-21)20-17(24-3)5-4-6-19(20)25-18/h4-8,13H,9-12,14H2,1-3H3.
What are the key properties of 7-methoxy-1',3-dimethyl-1'-oxidospiro[5H-benzo[b][1]benzothiepine-6,4'-piperidin-1-ium]?
7-methoxy-1',3-dimethyl-1'-oxidospiro[5H-benzo[b][1]benzothiepine-6,4'-piperidin-1-ium] has a molecular weight of 355.50 g/mol, XLogP of 4.69, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-1',3-dimethyl-1'-oxidospiro[5H-benzo[b][1]benzothiepine-6,4'-piperidin-1-ium] is sourced from PubChem (CID 88781147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).