C24H31F3O5S — CID 88781149
2-ethyl-7-[2-[2-hydroxy-3-(2,4,5-trifluoro-3-methylphenoxy)propyl]sulfanyl-5-oxocyclopent-3-en-1-yl]heptanoic acid (PubChem CID 88781149) has the molecular formula C24H31F3O5S and a molecular weight of 488.57 g/mol. Its IUPAC name is 2-ethyl-7-[2-[2-hydroxy-3-(2,4,5-trifluoro-3-methylphenoxy)propyl]sulfanyl-5-oxocyclopent-3-en-1-yl]heptanoic acid.
| Compound Name | 2-ethyl-7-[2-[2-hydroxy-3-(2,4,5-trifluoro-3-methylphenoxy)propyl]sulfanyl-5-oxocyclopent-3-en-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 88781149 |
| Molecular Formula | C24H31F3O5S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 2-ethyl-7-[2-[2-hydroxy-3-(2,4,5-trifluoro-3-methylphenoxy)propyl]sulfanyl-5-oxocyclopent-3-en-1-yl]heptanoic acid |
| SMILES | CCC(CCCCCC1C(=O)C=CC1SCC(O)COc1cc(F)c(F)c(C)c1F)C(=O)O |
| InChI | InChI=1S/C24H31F3O5S/c1-3-15(24(30)31)7-5-4-6-8-17-19(29)9-10-21(17)33-13-16(28)12-32-20-11-18(25)22(26)14(2)23(20)27/h9-11,15-17,21,28H,3-8,12-13H2,1-2H3,(H,30,31) |
| InChIKey | WKDNILOMQCOUAR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|