C21H37NO2S2 — CID 88781156
(Z)-2-(disulfanyl)-7-[(1R,2S)-2-[(E)-4-methyl-4-propoxypent-1-enyl]cyclopentyl]hept-5-enamide (PubChem CID 88781156) has the molecular formula C21H37NO2S2 and a molecular weight of 399.67 g/mol. Its IUPAC name is (Z)-2-(disulfanyl)-7-[(1R,2S)-2-[(E)-4-methyl-4-propoxypent-1-enyl]cyclopentyl]hept-5-enamide.
| Compound Name | (Z)-2-(disulfanyl)-7-[(1R,2S)-2-[(E)-4-methyl-4-propoxypent-1-enyl]cyclopentyl]hept-5-enamide |
|---|---|
| PubChem CID | 88781156 |
| Molecular Formula | C21H37NO2S2 |
| Molecular Weight | 399.67 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | (Z)-2-(disulfanyl)-7-[(1R,2S)-2-[(E)-4-methyl-4-propoxypent-1-enyl]cyclopentyl]hept-5-enamide |
| SMILES | CCCOC(C)(C)C/C=C/[C@H]1CCC[C@@H]1C/C=C\CCC(SS)C(N)=O |
| InChI | InChI=1S/C21H37NO2S2/c1-4-16-24-21(2,3)15-9-13-18-12-8-11-17(18)10-6-5-7-14-19(26-25)20(22)23/h5-6,9,13,17-19,25H,4,7-8,10-12,14-16H2,1-3H3,(H2,22,23)/b6-5-,13-9+/t17-,18+,19?/m0/s1 |
| InChIKey | NYQFIEDDGLPKGD-DQTHOBTRSA-N |
| XLogP | 5.71 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.67 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|