C14H27NO5S — CID 88781365
(7,7,8,9,9-pentamethyl-1,4-dioxa-8-azaspiro[4.5]decan-3-yl)methyl methanesulfonate (PubChem CID 88781365) has the molecular formula C14H27NO5S and a molecular weight of 321.44 g/mol. Its IUPAC name is (7,7,8,9,9-pentamethyl-1,4-dioxa-8-azaspiro[4.5]decan-3-yl)methyl methanesulfonate.
| Compound Name | (7,7,8,9,9-pentamethyl-1,4-dioxa-8-azaspiro[4.5]decan-3-yl)methyl methanesulfonate |
|---|---|
| PubChem CID | 88781365 |
| Molecular Formula | C14H27NO5S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | (7,7,8,9,9-pentamethyl-1,4-dioxa-8-azaspiro[4.5]decan-3-yl)methyl methanesulfonate |
| SMILES | CN1C(C)(C)CC2(CC1(C)C)OCC(COS(C)(=O)=O)O2 |
| InChI | InChI=1S/C14H27NO5S/c1-12(2)9-14(10-13(3,4)15(12)5)18-7-11(20-14)8-19-21(6,16)17/h11H,7-10H2,1-6H3 |
| InChIKey | NXBQVQMVFORZRV-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|