About [2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl] (2R)-2-fluoropyrrolidine-2-carboxylate
[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl] (2R)-2-fluoropyrrolidine-2-carboxylate (PubChem CID 88781379) has the molecular formula C11H13F4NO4S
and a molecular weight of 331.29 g/mol. Its IUPAC name is [2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl] (2R)-2-fluoropyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | [2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl] (2R)-2-fluoropyrrolidine-2-carboxylate |
| PubChem CID | 88781379 |
| Molecular Formula | C11H13F4NO4S |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | [2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl] (2R)-2-fluoropyrrolidine-2-carboxylate |
| SMILES | CC(=O)SCC(C(=O)OC(=O)[C@]1(F)CCCN1)C(F)(F)F |
| InChI | InChI=1S/C11H13F4NO4S/c1-6(17)21-5-7(11(13,14)15)8(18)20-9(19)10(12)3-2-4-16-10/h7,16H,2-5H2,1H3/t7?,10-/m0/s1 |
| InChIKey | JHHYNTDQPUBZIZ-MHPPCMCBSA-N |
| XLogP | 1.56 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze [2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl] (2R)-2-fluoropyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl] (2R)-2-fluoropyrrolidine-2-carboxylate?
The IUPAC name of [2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl] (2R)-2-fluoropyrrolidine-2-carboxylate (CID 88781379) is [2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl] (2R)-2-fluoropyrrolidine-2-carboxylate.
What is the SMILES notation for [2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl] (2R)-2-fluoropyrrolidine-2-carboxylate?
The canonical SMILES for [2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl] (2R)-2-fluoropyrrolidine-2-carboxylate is CC(=O)SCC(C(=O)OC(=O)[C@]1(F)CCCN1)C(F)(F)F.
What is the InChIKey of [2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl] (2R)-2-fluoropyrrolidine-2-carboxylate?
The InChIKey is JHHYNTDQPUBZIZ-MHPPCMCBSA-N. The full InChI is InChI=1S/C11H13F4NO4S/c1-6(17)21-5-7(11(13,14)15)8(18)20-9(19)10(12)3-2-4-16-10/h7,16H,2-5H2,1H3/t7?,10-/m0/s1.
What are the key properties of [2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl] (2R)-2-fluoropyrrolidine-2-carboxylate?
[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl] (2R)-2-fluoropyrrolidine-2-carboxylate has a molecular weight of 331.29 g/mol, XLogP of 1.56, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl] (2R)-2-fluoropyrrolidine-2-carboxylate is sourced from PubChem (CID 88781379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).