C8H11ClO4 — CID 88781594
2-[(1R,2R,3R,5R)-5-chloro-2-formyl-3-hydroxycyclopentyl]acetic acid (PubChem CID 88781594) has the molecular formula C8H11ClO4 and a molecular weight of 206.62 g/mol. Its IUPAC name is 2-[(1R,2R,3R,5R)-5-chloro-2-formyl-3-hydroxycyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2R,3R,5R)-5-chloro-2-formyl-3-hydroxycyclopentyl]acetic acid |
|---|---|
| PubChem CID | 88781594 |
| Molecular Formula | C8H11ClO4 |
| Molecular Weight | 206.62 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 2-[(1R,2R,3R,5R)-5-chloro-2-formyl-3-hydroxycyclopentyl]acetic acid |
| SMILES | O=C[C@@H]1[C@@H](CC(=O)O)[C@H](Cl)C[C@H]1O |
| InChI | InChI=1S/C8H11ClO4/c9-6-2-7(11)5(3-10)4(6)1-8(12)13/h3-7,11H,1-2H2,(H,12,13)/t4-,5-,6-,7-/m1/s1 |
| InChIKey | BNZPBOZMQGLRNO-DBRKOABJSA-N |
| XLogP | 0.26 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.62 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|