About 4-[(3-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]butanoic acid
4-[(3-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]butanoic acid (PubChem CID 88781739) has the molecular formula C9H10FN3O5
and a molecular weight of 259.19 g/mol. Its IUPAC name is 4-[(3-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]butanoic acid.
Molecular Properties
| Compound Name | 4-[(3-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]butanoic acid |
| PubChem CID | 88781739 |
| Molecular Formula | C9H10FN3O5 |
| Molecular Weight | 259.19 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 4-[(3-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)n1ccc(=O)n(F)c1=O |
| InChI | InChI=1S/C9H10FN3O5/c10-13-6(14)3-5-12(9(13)18)8(17)11-4-1-2-7(15)16/h3,5H,1-2,4H2,(H,11,17)(H,15,16) |
| InChIKey | DVNCDBOXYLGJHU-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.19 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]butanoic acid?
The IUPAC name of 4-[(3-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]butanoic acid (CID 88781739) is 4-[(3-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]butanoic acid.
What is the SMILES notation for 4-[(3-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]butanoic acid?
The canonical SMILES for 4-[(3-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]butanoic acid is O=C(O)CCCNC(=O)n1ccc(=O)n(F)c1=O.
What is the InChIKey of 4-[(3-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]butanoic acid?
The InChIKey is DVNCDBOXYLGJHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FN3O5/c10-13-6(14)3-5-12(9(13)18)8(17)11-4-1-2-7(15)16/h3,5H,1-2,4H2,(H,11,17)(H,15,16).
What are the key properties of 4-[(3-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]butanoic acid?
4-[(3-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]butanoic acid has a molecular weight of 259.19 g/mol, XLogP of -0.83, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]butanoic acid is sourced from PubChem (CID 88781739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).