C14H26N2O — CID 88781933
(NE)-N-[(4E,8E)-11-amino-2-propan-2-ylundeca-4,8-dienylidene]hydroxylamine (PubChem CID 88781933) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is (NE)-N-[(4E,8E)-11-amino-2-propan-2-ylundeca-4,8-dienylidene]hydroxylamine.
| Compound Name | (NE)-N-[(4E,8E)-11-amino-2-propan-2-ylundeca-4,8-dienylidene]hydroxylamine |
|---|---|
| PubChem CID | 88781933 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | (NE)-N-[(4E,8E)-11-amino-2-propan-2-ylundeca-4,8-dienylidene]hydroxylamine |
| SMILES | CC(C)C(/C=N/O)C/C=C/CC/C=C/CCN |
| InChI | InChI=1S/C14H26N2O/c1-13(2)14(12-16-17)10-8-6-4-3-5-7-9-11-15/h5-8,12-14,17H,3-4,9-11,15H2,1-2H3/b7-5+,8-6+,16-12+ |
| InChIKey | SWJAIWHHGNXVOI-NWGUBJHJSA-N |
| XLogP | 3.35 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|