About lead(2+);2-phenoxyethyl phosphite
lead(2+);2-phenoxyethyl phosphite (PubChem CID 88782126) has the molecular formula C8H9O4PPb
and a molecular weight of 407.33 g/mol. Its IUPAC name is lead(2+);2-phenoxyethyl phosphite.
Molecular Properties
| Compound Name | lead(2+);2-phenoxyethyl phosphite |
| PubChem CID | 88782126 |
| Molecular Formula | C8H9O4PPb |
| Molecular Weight | 407.33 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | lead(2+);2-phenoxyethyl phosphite |
| SMILES | [O-]P([O-])OCCOc1ccccc1.[Pb+2] |
| InChI | InChI=1S/C8H9O4P.Pb/c9-13(10)12-7-6-11-8-4-2-1-3-5-8;/h1-5H,6-7H2;/q-2;+2 |
| InChIKey | GXQVXWQITACHQO-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 64.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.33 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lead(2+);2-phenoxyethyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lead(2+);2-phenoxyethyl phosphite?
The IUPAC name of lead(2+);2-phenoxyethyl phosphite (CID 88782126) is lead(2+);2-phenoxyethyl phosphite.
What is the SMILES notation for lead(2+);2-phenoxyethyl phosphite?
The canonical SMILES for lead(2+);2-phenoxyethyl phosphite is [O-]P([O-])OCCOc1ccccc1.[Pb+2].
What is the InChIKey of lead(2+);2-phenoxyethyl phosphite?
The InChIKey is GXQVXWQITACHQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9O4P.Pb/c9-13(10)12-7-6-11-8-4-2-1-3-5-8;/h1-5H,6-7H2;/q-2;+2.
What are the key properties of lead(2+);2-phenoxyethyl phosphite?
lead(2+);2-phenoxyethyl phosphite has a molecular weight of 407.33 g/mol, XLogP of -0.35, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lead(2+);2-phenoxyethyl phosphite is sourced from PubChem (CID 88782126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).