C12H9N5OS — CID 88782245
S-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl) carbamothioate (PubChem CID 88782245) has the molecular formula C12H9N5OS and a molecular weight of 271.31 g/mol. Its IUPAC name is S-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl) carbamothioate.
| Compound Name | S-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl) carbamothioate |
|---|---|
| PubChem CID | 88782245 |
| Molecular Formula | C12H9N5OS |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | S-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl) carbamothioate |
| SMILES | NC(=O)Sc1ncnc2c1cnn2-c1ccccc1 |
| InChI | InChI=1S/C12H9N5OS/c13-12(18)19-11-9-6-16-17(10(9)14-7-15-11)8-4-2-1-3-5-8/h1-7H,(H2,13,18) |
| InChIKey | VMAREECWAGPSLK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|