About (2-acetylsulfanyl-3,3,3-trifluoropropanoyl) (2S)-pyrrolidine-2-carboxylate
(2-acetylsulfanyl-3,3,3-trifluoropropanoyl) (2S)-pyrrolidine-2-carboxylate (PubChem CID 88782310) has the molecular formula C10H12F3NO4S
and a molecular weight of 299.27 g/mol. Its IUPAC name is (2-acetylsulfanyl-3,3,3-trifluoropropanoyl) (2S)-pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | (2-acetylsulfanyl-3,3,3-trifluoropropanoyl) (2S)-pyrrolidine-2-carboxylate |
| PubChem CID | 88782310 |
| Molecular Formula | C10H12F3NO4S |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | (2-acetylsulfanyl-3,3,3-trifluoropropanoyl) (2S)-pyrrolidine-2-carboxylate |
| SMILES | CC(=O)SC(C(=O)OC(=O)[C@@H]1CCCN1)C(F)(F)F |
| InChI | InChI=1S/C10H12F3NO4S/c1-5(15)19-7(10(11,12)13)9(17)18-8(16)6-3-2-4-14-6/h6-7,14H,2-4H2,1H3/t6-,7?/m0/s1 |
| InChIKey | ZJSRICRWSMNZIK-PKPIPKONSA-N |
| XLogP | 1.02 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze (2-acetylsulfanyl-3,3,3-trifluoropropanoyl) (2S)-pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetylsulfanyl-3,3,3-trifluoropropanoyl) (2S)-pyrrolidine-2-carboxylate?
The IUPAC name of (2-acetylsulfanyl-3,3,3-trifluoropropanoyl) (2S)-pyrrolidine-2-carboxylate (CID 88782310) is (2-acetylsulfanyl-3,3,3-trifluoropropanoyl) (2S)-pyrrolidine-2-carboxylate.
What is the SMILES notation for (2-acetylsulfanyl-3,3,3-trifluoropropanoyl) (2S)-pyrrolidine-2-carboxylate?
The canonical SMILES for (2-acetylsulfanyl-3,3,3-trifluoropropanoyl) (2S)-pyrrolidine-2-carboxylate is CC(=O)SC(C(=O)OC(=O)[C@@H]1CCCN1)C(F)(F)F.
What is the InChIKey of (2-acetylsulfanyl-3,3,3-trifluoropropanoyl) (2S)-pyrrolidine-2-carboxylate?
The InChIKey is ZJSRICRWSMNZIK-PKPIPKONSA-N. The full InChI is InChI=1S/C10H12F3NO4S/c1-5(15)19-7(10(11,12)13)9(17)18-8(16)6-3-2-4-14-6/h6-7,14H,2-4H2,1H3/t6-,7?/m0/s1.
What are the key properties of (2-acetylsulfanyl-3,3,3-trifluoropropanoyl) (2S)-pyrrolidine-2-carboxylate?
(2-acetylsulfanyl-3,3,3-trifluoropropanoyl) (2S)-pyrrolidine-2-carboxylate has a molecular weight of 299.27 g/mol, XLogP of 1.02, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetylsulfanyl-3,3,3-trifluoropropanoyl) (2S)-pyrrolidine-2-carboxylate is sourced from PubChem (CID 88782310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).