C17H26O3 — CID 88782405
(3E)-4,9,13-trimethyl-8,16-dioxatricyclo[13.1.0.07,9]hexadec-3-en-2-one (PubChem CID 88782405) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (3E)-4,9,13-trimethyl-8,16-dioxatricyclo[13.1.0.07,9]hexadec-3-en-2-one.
| Compound Name | (3E)-4,9,13-trimethyl-8,16-dioxatricyclo[13.1.0.07,9]hexadec-3-en-2-one |
|---|---|
| PubChem CID | 88782405 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (3E)-4,9,13-trimethyl-8,16-dioxatricyclo[13.1.0.07,9]hexadec-3-en-2-one |
| SMILES | C/C1=C\C(=O)C2OC2CC(C)CCCC2(C)OC2CC1 |
| InChI | InChI=1S/C17H26O3/c1-11-5-4-8-17(3)15(20-17)7-6-12(2)9-13(18)16-14(10-11)19-16/h9,11,14-16H,4-8,10H2,1-3H3/b12-9+ |
| InChIKey | CGELBWIHDKGUJQ-FMIVXFBMSA-N |
| XLogP | 3.42 |
| TPSA | 42.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|